C17H18FN3O4S — CID 122616096
N-[[6-amino-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]acetamide (PubChem CID 122616096) has the molecular formula C17H18FN3O4S and a molecular weight of 379.41 g/mol. Its IUPAC name is N-[[6-amino-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]acetamide.
| Compound Name | N-[[6-amino-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 122616096 |
| Molecular Formula | C17H18FN3O4S |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-[[6-amino-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CN(S(=O)(=O)c2ccc(F)cc2)c2cc(N)ccc2O1 |
| InChI | InChI=1S/C17H18FN3O4S/c1-11(22)20-9-14-10-21(16-8-13(19)4-7-17(16)25-14)26(23,24)15-5-2-12(18)3-6-15/h2-8,14H,9-10,19H2,1H3,(H,20,22) |
| InChIKey | XRUAPVFIVMJQGI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|