C20H22FN3O7S — CID 69092215
tert-butyl N-[[4-(4-fluorophenyl)sulfonyl-6-nitro-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]carbamate (PubChem CID 69092215) has the molecular formula C20H22FN3O7S and a molecular weight of 467.48 g/mol. Its IUPAC name is tert-butyl N-[[4-(4-fluorophenyl)sulfonyl-6-nitro-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-(4-fluorophenyl)sulfonyl-6-nitro-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 69092215 |
| Molecular Formula | C20H22FN3O7S |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | tert-butyl N-[[4-(4-fluorophenyl)sulfonyl-6-nitro-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CN(S(=O)(=O)c2ccc(F)cc2)c2cc([N+](=O)[O-])ccc2O1 |
| InChI | InChI=1S/C20H22FN3O7S/c1-20(2,3)31-19(25)22-11-15-12-23(32(28,29)16-7-4-13(21)5-8-16)17-10-14(24(26)27)6-9-18(17)30-15/h4-10,15H,11-12H2,1-3H3,(H,22,25) |
| InChIKey | BGOYWKBMZXXPCW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|