C22H21F3N2O4 — CID 122619573
(7R)-N-hydroxy-2'-oxo-1'-[[2-(trifluoromethoxy)phenyl]methyl]spiro[6,8-dihydro-5H-naphthalene-7,3'-pyrrolidine]-2-carboxamide (PubChem CID 122619573) has the molecular formula C22H21F3N2O4 and a molecular weight of 434.41 g/mol. Its IUPAC name is (7R)-N-hydroxy-2'-oxo-1'-[[2-(trifluoromethoxy)phenyl]methyl]spiro[6,8-dihydro-5H-naphthalene-7,3'-pyrrolidine]-2-carboxamide.
| Compound Name | (7R)-N-hydroxy-2'-oxo-1'-[[2-(trifluoromethoxy)phenyl]methyl]spiro[6,8-dihydro-5H-naphthalene-7,3'-pyrrolidine]-2-carboxamide |
|---|---|
| PubChem CID | 122619573 |
| Molecular Formula | C22H21F3N2O4 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | (7R)-N-hydroxy-2'-oxo-1'-[[2-(trifluoromethoxy)phenyl]methyl]spiro[6,8-dihydro-5H-naphthalene-7,3'-pyrrolidine]-2-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)C[C@]1(CC2)CCN(Cc2ccccc2OC(F)(F)F)C1=O |
| InChI | InChI=1S/C22H21F3N2O4/c23-22(24,25)31-18-4-2-1-3-16(18)13-27-10-9-21(20(27)29)8-7-14-5-6-15(19(28)26-30)11-17(14)12-21/h1-6,11,30H,7-10,12-13H2,(H,26,28)/t21-/m0/s1 |
| InChIKey | WPAMMGVDEOZEHI-NRFANRHFSA-N |
| XLogP | 3.61 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|