C22H21F3N2O4 — CID 134492554
N-hydroxy-2'-oxo-1'-[[2-(1,2,2-trifluoroethoxy)phenyl]methyl]spiro[1,3-dihydroindene-2,3'-pyrrolidine]-4-carboxamide (PubChem CID 134492554) has the molecular formula C22H21F3N2O4 and a molecular weight of 434.41 g/mol. Its IUPAC name is N-hydroxy-2'-oxo-1'-[[2-(1,2,2-trifluoroethoxy)phenyl]methyl]spiro[1,3-dihydroindene-2,3'-pyrrolidine]-4-carboxamide.
| Compound Name | N-hydroxy-2'-oxo-1'-[[2-(1,2,2-trifluoroethoxy)phenyl]methyl]spiro[1,3-dihydroindene-2,3'-pyrrolidine]-4-carboxamide |
|---|---|
| PubChem CID | 134492554 |
| Molecular Formula | C22H21F3N2O4 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | N-hydroxy-2'-oxo-1'-[[2-(1,2,2-trifluoroethoxy)phenyl]methyl]spiro[1,3-dihydroindene-2,3'-pyrrolidine]-4-carboxamide |
| SMILES | O=C(NO)c1cccc2c1CC1(CCN(Cc3ccccc3OC(F)C(F)F)C1=O)C2 |
| InChI | InChI=1S/C22H21F3N2O4/c23-18(24)19(25)31-17-7-2-1-4-14(17)12-27-9-8-22(21(27)29)10-13-5-3-6-15(16(13)11-22)20(28)26-30/h1-7,18-19,30H,8-12H2,(H,26,28) |
| InChIKey | YLWIQCCMFBSEBX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|