C21H19NO4S2 — CID 122622654
methyl 2-(benzenesulfonamido)-5-benzylsulfanylbenzoate (PubChem CID 122622654) has the molecular formula C21H19NO4S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is methyl 2-(benzenesulfonamido)-5-benzylsulfanylbenzoate.
| Compound Name | methyl 2-(benzenesulfonamido)-5-benzylsulfanylbenzoate |
|---|---|
| PubChem CID | 122622654 |
| Molecular Formula | C21H19NO4S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | methyl 2-(benzenesulfonamido)-5-benzylsulfanylbenzoate |
| SMILES | COC(=O)c1cc(SCc2ccccc2)ccc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H19NO4S2/c1-26-21(23)19-14-17(27-15-16-8-4-2-5-9-16)12-13-20(19)22-28(24,25)18-10-6-3-7-11-18/h2-14,22H,15H2,1H3 |
| InChIKey | OFEMDAJDRSIJQY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |