C19H19ClF2NO3- — CID 122623300
(3R,4R)-5-(4-chlorophenyl)-4-(2,4-difluorophenyl)-3-ethoxy-N-oxidopentanamide (PubChem CID 122623300) has the molecular formula C19H19ClF2NO3- and a molecular weight of 382.81 g/mol. Its IUPAC name is (3R,4R)-5-(4-chlorophenyl)-4-(2,4-difluorophenyl)-3-ethoxy-N-oxidopentanamide.
| Compound Name | (3R,4R)-5-(4-chlorophenyl)-4-(2,4-difluorophenyl)-3-ethoxy-N-oxidopentanamide |
|---|---|
| PubChem CID | 122623300 |
| Molecular Formula | C19H19ClF2NO3- |
| Molecular Weight | 382.81 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (3R,4R)-5-(4-chlorophenyl)-4-(2,4-difluorophenyl)-3-ethoxy-N-oxidopentanamide |
| SMILES | CCO[C@H](CC(=O)N[O-])[C@H](Cc1ccc(Cl)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H19ClF2NO3/c1-2-26-18(11-19(24)23-25)16(9-12-3-5-13(20)6-4-12)15-8-7-14(21)10-17(15)22/h3-8,10,16,18H,2,9,11H2,1H3,(H-,23,24,25)/q-1/t16-,18-/m1/s1 |
| InChIKey | QMYBLUWCFSDPIJ-SJLPKXTDSA-N |
| XLogP | 4.35 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.81 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|