C19H20ClFNO3- — CID 122623307
(3R,4R)-5-(4-chloro-2-methylphenyl)-4-(4-fluorophenyl)-3-methoxy-N-oxidopentanamide (PubChem CID 122623307) has the molecular formula C19H20ClFNO3- and a molecular weight of 364.82 g/mol. Its IUPAC name is (3R,4R)-5-(4-chloro-2-methylphenyl)-4-(4-fluorophenyl)-3-methoxy-N-oxidopentanamide.
| Compound Name | (3R,4R)-5-(4-chloro-2-methylphenyl)-4-(4-fluorophenyl)-3-methoxy-N-oxidopentanamide |
|---|---|
| PubChem CID | 122623307 |
| Molecular Formula | C19H20ClFNO3- |
| Molecular Weight | 364.82 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (3R,4R)-5-(4-chloro-2-methylphenyl)-4-(4-fluorophenyl)-3-methoxy-N-oxidopentanamide |
| SMILES | CO[C@H](CC(=O)N[O-])[C@H](Cc1ccc(Cl)cc1C)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H20ClFNO3/c1-12-9-15(20)6-3-14(12)10-17(13-4-7-16(21)8-5-13)18(25-2)11-19(23)22-24/h3-9,17-18H,10-11H2,1-2H3,(H-,22,23,24)/q-1/t17-,18-/m1/s1 |
| InChIKey | LIIGIZXVOLKCHR-QZTJIDSGSA-N |
| XLogP | 4.13 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.82 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|