C18H17ClF2NO3- — CID 122623313
(3R,4R)-5-(4-chlorophenyl)-4-(2,4-difluorophenyl)-3-methoxy-N-oxidopentanamide (PubChem CID 122623313) has the molecular formula C18H17ClF2NO3- and a molecular weight of 368.79 g/mol. Its IUPAC name is (3R,4R)-5-(4-chlorophenyl)-4-(2,4-difluorophenyl)-3-methoxy-N-oxidopentanamide.
| Compound Name | (3R,4R)-5-(4-chlorophenyl)-4-(2,4-difluorophenyl)-3-methoxy-N-oxidopentanamide |
|---|---|
| PubChem CID | 122623313 |
| Molecular Formula | C18H17ClF2NO3- |
| Molecular Weight | 368.79 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | (3R,4R)-5-(4-chlorophenyl)-4-(2,4-difluorophenyl)-3-methoxy-N-oxidopentanamide |
| SMILES | CO[C@H](CC(=O)N[O-])[C@H](Cc1ccc(Cl)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H17ClF2NO3/c1-25-17(10-18(23)22-24)15(8-11-2-4-12(19)5-3-11)14-7-6-13(20)9-16(14)21/h2-7,9,15,17H,8,10H2,1H3,(H-,22,23,24)/q-1/t15-,17-/m1/s1 |
| InChIKey | LRCXVFOUMFMJLD-NVXWUHKLSA-N |
| XLogP | 3.96 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.79 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|