C19H20BrClFNO3 — CID 122623366
(3R,4R)-4-(4-bromo-2-fluorophenyl)-5-(4-chloro-2-methylphenyl)-N-hydroxy-3-methoxypentanamide (PubChem CID 122623366) has the molecular formula C19H20BrClFNO3 and a molecular weight of 444.73 g/mol. Its IUPAC name is (3R,4R)-4-(4-bromo-2-fluorophenyl)-5-(4-chloro-2-methylphenyl)-N-hydroxy-3-methoxypentanamide.
| Compound Name | (3R,4R)-4-(4-bromo-2-fluorophenyl)-5-(4-chloro-2-methylphenyl)-N-hydroxy-3-methoxypentanamide |
|---|---|
| PubChem CID | 122623366 |
| Molecular Formula | C19H20BrClFNO3 |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | (3R,4R)-4-(4-bromo-2-fluorophenyl)-5-(4-chloro-2-methylphenyl)-N-hydroxy-3-methoxypentanamide |
| SMILES | CO[C@H](CC(=O)NO)[C@H](Cc1ccc(Cl)cc1C)c1ccc(Br)cc1F |
| InChI | InChI=1S/C19H20BrClFNO3/c1-11-7-14(21)5-3-12(11)8-16(18(26-2)10-19(24)23-25)15-6-4-13(20)9-17(15)22/h3-7,9,16,18,25H,8,10H2,1-2H3,(H,23,24)/t16-,18-/m1/s1 |
| InChIKey | JTAGRPSWLSQAGL-SJLPKXTDSA-N |
| XLogP | 4.79 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|