C19H22ClF2KNO3+ — CID 140752974
oxidanium;potassium;[(3R)-5-(4-chloro-2-methylphenyl)-4-(2,4-difluorophenyl)-3-methoxypentanoyl]azanide (PubChem CID 140752974) has the molecular formula C19H22ClF2KNO3+ and a molecular weight of 424.94 g/mol. Its IUPAC name is oxidanium;potassium;[(3R)-5-(4-chloro-2-methylphenyl)-4-(2,4-difluorophenyl)-3-methoxypentanoyl]azanide.
| Compound Name | oxidanium;potassium;[(3R)-5-(4-chloro-2-methylphenyl)-4-(2,4-difluorophenyl)-3-methoxypentanoyl]azanide |
|---|---|
| PubChem CID | 140752974 |
| Molecular Formula | C19H22ClF2KNO3+ |
| Molecular Weight | 424.94 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | oxidanium;potassium;[(3R)-5-(4-chloro-2-methylphenyl)-4-(2,4-difluorophenyl)-3-methoxypentanoyl]azanide |
| SMILES | CO[C@H](CC([NH-])=O)C(Cc1ccc(Cl)cc1C)c1ccc(F)cc1F.[K+].[OH3+] |
| InChI | InChI=1S/C19H20ClF2NO2.K.H2O/c1-11-7-13(20)4-3-12(11)8-16(18(25-2)10-19(23)24)15-6-5-14(21)9-17(15)22;;/h3-7,9,16,18H,8,10H2,1-2H3,(H2,23,24);;1H2/q;+1;/t16?,18-;;/m1../s1 |
| InChIKey | QSJCBJDVBJGTFQ-UNNXDVLSSA-N |
| XLogP | 1.32 |
| TPSA | 83.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.94 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|