C19H20ClF2NO3 — CID 145170995
5-(4-chlorophenyl)-4-(2,4-difluorophenyl)-3-ethoxy-N-hydroxypentanamide (PubChem CID 145170995) has the molecular formula C19H20ClF2NO3 and a molecular weight of 383.82 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-(2,4-difluorophenyl)-3-ethoxy-N-hydroxypentanamide.
| Compound Name | 5-(4-chlorophenyl)-4-(2,4-difluorophenyl)-3-ethoxy-N-hydroxypentanamide |
|---|---|
| PubChem CID | 145170995 |
| Molecular Formula | C19H20ClF2NO3 |
| Molecular Weight | 383.82 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 5-(4-chlorophenyl)-4-(2,4-difluorophenyl)-3-ethoxy-N-hydroxypentanamide |
| SMILES | CCOC(CC(=O)NO)C(Cc1ccc(Cl)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H20ClF2NO3/c1-2-26-18(11-19(24)23-25)16(9-12-3-5-13(20)6-4-12)15-8-7-14(21)10-17(15)22/h3-8,10,16,18,25H,2,9,11H2,1H3,(H,23,24) |
| InChIKey | LRQBGFUQXOIFTO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.82 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|