C19H20ClFKNO3 — CID 122623391
potassium (3R,4R)-5-(4-chlorophenyl)-3-ethoxy-4-(4-fluorophenyl)-N-oxidopentanamide (PubChem CID 122623391) has the molecular formula C19H20ClFKNO3 and a molecular weight of 403.92 g/mol. Its IUPAC name is potassium (3R,4R)-5-(4-chlorophenyl)-3-ethoxy-4-(4-fluorophenyl)-N-oxidopentanamide.
| Compound Name | potassium (3R,4R)-5-(4-chlorophenyl)-3-ethoxy-4-(4-fluorophenyl)-N-oxidopentanamide |
|---|---|
| PubChem CID | 122623391 |
| Molecular Formula | C19H20ClFKNO3 |
| Molecular Weight | 403.92 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | potassium (3R,4R)-5-(4-chlorophenyl)-3-ethoxy-4-(4-fluorophenyl)-N-oxidopentanamide |
| SMILES | CCO[C@H](CC(=O)N[O-])[C@H](Cc1ccc(Cl)cc1)c1ccc(F)cc1.[K+] |
| InChI | InChI=1S/C19H20ClFNO3.K/c1-2-25-18(12-19(23)22-24)17(14-5-9-16(21)10-6-14)11-13-3-7-15(20)8-4-13;/h3-10,17-18H,2,11-12H2,1H3,(H-,22,23,24);/q-1;+1/t17-,18-;/m1./s1 |
| InChIKey | NZYSGPRCHGTIQR-JAXOOIEVSA-N |
| XLogP | 1.22 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.92 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|