C20H22BrClO — CID 145171014
1-bromo-4-[(2R)-1-(4-chlorophenyl)-3-ethoxyhex-5-en-2-yl]benzene (PubChem CID 145171014) has the molecular formula C20H22BrClO and a molecular weight of 393.75 g/mol. Its IUPAC name is 1-bromo-4-[(2R)-1-(4-chlorophenyl)-3-ethoxyhex-5-en-2-yl]benzene.
| Compound Name | 1-bromo-4-[(2R)-1-(4-chlorophenyl)-3-ethoxyhex-5-en-2-yl]benzene |
|---|---|
| PubChem CID | 145171014 |
| Molecular Formula | C20H22BrClO |
| Molecular Weight | 393.75 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 1-bromo-4-[(2R)-1-(4-chlorophenyl)-3-ethoxyhex-5-en-2-yl]benzene |
| SMILES | C=CCC(OCC)[C@H](Cc1ccc(Cl)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H22BrClO/c1-3-5-20(23-4-2)19(16-8-10-17(21)11-9-16)14-15-6-12-18(22)13-7-15/h3,6-13,19-20H,1,4-5,14H2,2H3/t19-,20?/m1/s1 |
| InChIKey | JMSCMMPGIVKWBJ-FIWHBWSRSA-N |
| XLogP | 6.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.75 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|