C29H40ClN3O5 — CID 122623402
tert-butyl 4-[[4-[(2R,3R)-1-(4-chlorophenyl)-3-ethoxy-5-(hydroxyamino)-5-oxopentan-2-yl]phenyl]methyl]piperazine-1-carboxylate (PubChem CID 122623402) has the molecular formula C29H40ClN3O5 and a molecular weight of 546.11 g/mol. Its IUPAC name is tert-butyl 4-[[4-[(2R,3R)-1-(4-chlorophenyl)-3-ethoxy-5-(hydroxyamino)-5-oxopentan-2-yl]phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[(2R,3R)-1-(4-chlorophenyl)-3-ethoxy-5-(hydroxyamino)-5-oxopentan-2-yl]phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 122623402 |
| Molecular Formula | C29H40ClN3O5 |
| Molecular Weight | 546.11 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | tert-butyl 4-[[4-[(2R,3R)-1-(4-chlorophenyl)-3-ethoxy-5-(hydroxyamino)-5-oxopentan-2-yl]phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CCO[C@H](CC(=O)NO)[C@H](Cc1ccc(Cl)cc1)c1ccc(CN2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C29H40ClN3O5/c1-5-37-26(19-27(34)31-36)25(18-21-8-12-24(30)13-9-21)23-10-6-22(7-11-23)20-32-14-16-33(17-15-32)28(35)38-29(2,3)4/h6-13,25-26,36H,5,14-20H2,1-4H3,(H,31,34)/t25-,26-/m1/s1 |
| InChIKey | QTVDOUYAKPDWQN-CLJLJLNGSA-N |
| XLogP | 5.02 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.11 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|