C23H27ClN2O5 — CID 145170986
(4R)-5-(4-chlorophenyl)-N-hydroxy-3-methoxy-4-[4-(morpholine-4-carbonyl)phenyl]pentanamide (PubChem CID 145170986) has the molecular formula C23H27ClN2O5 and a molecular weight of 446.93 g/mol. Its IUPAC name is (4R)-5-(4-chlorophenyl)-N-hydroxy-3-methoxy-4-[4-(morpholine-4-carbonyl)phenyl]pentanamide.
| Compound Name | (4R)-5-(4-chlorophenyl)-N-hydroxy-3-methoxy-4-[4-(morpholine-4-carbonyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 145170986 |
| Molecular Formula | C23H27ClN2O5 |
| Molecular Weight | 446.93 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | (4R)-5-(4-chlorophenyl)-N-hydroxy-3-methoxy-4-[4-(morpholine-4-carbonyl)phenyl]pentanamide |
| SMILES | COC(CC(=O)NO)[C@H](Cc1ccc(Cl)cc1)c1ccc(C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H27ClN2O5/c1-30-21(15-22(27)25-29)20(14-16-2-8-19(24)9-3-16)17-4-6-18(7-5-17)23(28)26-10-12-31-13-11-26/h2-9,20-21,29H,10-15H2,1H3,(H,25,27)/t20-,21?/m1/s1 |
| InChIKey | XWDQDPIWNAQCPL-VQCQRNETSA-N |
| XLogP | 3.05 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.93 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|