C24H25FN2O3 — CID 122623230
(3R,4R)-3-ethoxy-4-(4-fluorophenyl)-N-hydroxy-5-(4-pyridin-4-ylphenyl)pentanamide (PubChem CID 122623230) has the molecular formula C24H25FN2O3 and a molecular weight of 408.47 g/mol. Its IUPAC name is (3R,4R)-3-ethoxy-4-(4-fluorophenyl)-N-hydroxy-5-(4-pyridin-4-ylphenyl)pentanamide.
| Compound Name | (3R,4R)-3-ethoxy-4-(4-fluorophenyl)-N-hydroxy-5-(4-pyridin-4-ylphenyl)pentanamide |
|---|---|
| PubChem CID | 122623230 |
| Molecular Formula | C24H25FN2O3 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | (3R,4R)-3-ethoxy-4-(4-fluorophenyl)-N-hydroxy-5-(4-pyridin-4-ylphenyl)pentanamide |
| SMILES | CCO[C@H](CC(=O)NO)[C@H](Cc1ccc(-c2ccncc2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H25FN2O3/c1-2-30-23(16-24(28)27-29)22(20-7-9-21(25)10-8-20)15-17-3-5-18(6-4-17)19-11-13-26-14-12-19/h3-14,22-23,29H,2,15-16H2,1H3,(H,27,28)/t22-,23-/m1/s1 |
| InChIKey | HVKUCFJHPZUCJU-DHIUTWEWSA-N |
| XLogP | 4.51 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|