C18H16ClF4NO3 — CID 122623397
(3R,4R)-5-(4-chlorophenyl)-N-hydroxy-3-methoxy-4-(2,3,4,5-tetrafluorophenyl)pentanamide (PubChem CID 122623397) has the molecular formula C18H16ClF4NO3 and a molecular weight of 405.78 g/mol. Its IUPAC name is (3R,4R)-5-(4-chlorophenyl)-N-hydroxy-3-methoxy-4-(2,3,4,5-tetrafluorophenyl)pentanamide.
| Compound Name | (3R,4R)-5-(4-chlorophenyl)-N-hydroxy-3-methoxy-4-(2,3,4,5-tetrafluorophenyl)pentanamide |
|---|---|
| PubChem CID | 122623397 |
| Molecular Formula | C18H16ClF4NO3 |
| Molecular Weight | 405.78 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | (3R,4R)-5-(4-chlorophenyl)-N-hydroxy-3-methoxy-4-(2,3,4,5-tetrafluorophenyl)pentanamide |
| SMILES | CO[C@H](CC(=O)NO)[C@H](Cc1ccc(Cl)cc1)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H16ClF4NO3/c1-27-14(8-15(25)24-26)11(6-9-2-4-10(19)5-3-9)12-7-13(20)17(22)18(23)16(12)21/h2-5,7,11,14,26H,6,8H2,1H3,(H,24,25)/t11-,14-/m1/s1 |
| InChIKey | UAQRGKWMFFGLSF-BXUZGUMPSA-N |
| XLogP | 4.13 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.78 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|