C17H20N4O2 — CID 122624076
4-[6-(4-methylanilino)-2-pyridinyl]piperazine-1-carboxylic acid (PubChem CID 122624076) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 4-[6-(4-methylanilino)-2-pyridinyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[6-(4-methylanilino)-2-pyridinyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 122624076 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 4-[6-(4-methylanilino)-2-pyridinyl]piperazine-1-carboxylic acid |
| SMILES | Cc1ccc(Nc2cccc(N3CCN(C(=O)O)CC3)n2)cc1 |
| InChI | InChI=1S/C17H20N4O2/c1-13-5-7-14(8-6-13)18-15-3-2-4-16(19-15)20-9-11-21(12-10-20)17(22)23/h2-8H,9-12H2,1H3,(H,18,19)(H,22,23) |
| InChIKey | DPWHLEYFYNKZEM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |