C18H23F3N4O2 — CID 122624376
tert-butyl 4-[2-[4-amino-6-methyl-2-(trifluoromethyl)pyrimidin-5-yl]ethynyl]piperidine-1-carboxylate (PubChem CID 122624376) has the molecular formula C18H23F3N4O2 and a molecular weight of 384.40 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-amino-6-methyl-2-(trifluoromethyl)pyrimidin-5-yl]ethynyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[4-amino-6-methyl-2-(trifluoromethyl)pyrimidin-5-yl]ethynyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 122624376 |
| Molecular Formula | C18H23F3N4O2 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | tert-butyl 4-[2-[4-amino-6-methyl-2-(trifluoromethyl)pyrimidin-5-yl]ethynyl]piperidine-1-carboxylate |
| SMILES | Cc1nc(C(F)(F)F)nc(N)c1C#CC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H23F3N4O2/c1-11-13(14(22)24-15(23-11)18(19,20)21)6-5-12-7-9-25(10-8-12)16(26)27-17(2,3)4/h12H,7-10H2,1-4H3,(H2,22,23,24) |
| InChIKey | GMAMYXROFJBZIH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|