C20H21N3O3 — CID 122624491
(6R)-N-hydroxy-2'-oxo-N-(pyridin-3-ylmethyl)spiro[7,8-dihydro-5H-naphthalene-6,4'-pyrrolidine]-2-carboxamide (PubChem CID 122624491) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is (6R)-N-hydroxy-2'-oxo-N-(pyridin-3-ylmethyl)spiro[7,8-dihydro-5H-naphthalene-6,4'-pyrrolidine]-2-carboxamide.
| Compound Name | (6R)-N-hydroxy-2'-oxo-N-(pyridin-3-ylmethyl)spiro[7,8-dihydro-5H-naphthalene-6,4'-pyrrolidine]-2-carboxamide |
|---|---|
| PubChem CID | 122624491 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (6R)-N-hydroxy-2'-oxo-N-(pyridin-3-ylmethyl)spiro[7,8-dihydro-5H-naphthalene-6,4'-pyrrolidine]-2-carboxamide |
| SMILES | O=C1C[C@]2(CCc3cc(C(=O)N(O)Cc4cccnc4)ccc3C2)CN1 |
| InChI | InChI=1S/C20H21N3O3/c24-18-10-20(13-22-18)6-5-15-8-16(3-4-17(15)9-20)19(25)23(26)12-14-2-1-7-21-11-14/h1-4,7-8,11,26H,5-6,9-10,12-13H2,(H,22,24)/t20-/m1/s1 |
| InChIKey | UXQAIYVAUUPLCY-HXUWFJFHSA-N |
| XLogP | 2.11 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|