C20H23F3N4O3S — CID 122625097
N-(aminomethyl)-N-[1-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]carbamoyl]cyclobutyl]cyclopentanecarboxamide (PubChem CID 122625097) has the molecular formula C20H23F3N4O3S and a molecular weight of 456.49 g/mol. Its IUPAC name is N-(aminomethyl)-N-[1-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]carbamoyl]cyclobutyl]cyclopentanecarboxamide.
| Compound Name | N-(aminomethyl)-N-[1-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]carbamoyl]cyclobutyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 122625097 |
| Molecular Formula | C20H23F3N4O3S |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N-(aminomethyl)-N-[1-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]carbamoyl]cyclobutyl]cyclopentanecarboxamide |
| SMILES | NCN(C(=O)C1CCCC1)C1(C(=O)Nc2nc3ccc(OC(F)(F)F)cc3s2)CCC1 |
| InChI | InChI=1S/C20H23F3N4O3S/c21-20(22,23)30-13-6-7-14-15(10-13)31-18(25-14)26-17(29)19(8-3-9-19)27(11-24)16(28)12-4-1-2-5-12/h6-7,10,12H,1-5,8-9,11,24H2,(H,25,26,29) |
| InChIKey | VPUSHDYLRIJXAX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|