C27H23F2N7O4S — CID 122625472
2-[2-fluoro-4-[2-(2-fluoro-3-nitrophenyl)ethynyl]phenyl]sulfanyl-5-methoxy-N-(5-methyl-1H-pyrazol-3-yl)-6-morpholin-4-ylpyrimidin-4-amine (PubChem CID 122625472) has the molecular formula C27H23F2N7O4S and a molecular weight of 579.59 g/mol. Its IUPAC name is 2-[2-fluoro-4-[2-(2-fluoro-3-nitrophenyl)ethynyl]phenyl]sulfanyl-5-methoxy-N-(5-methyl-1H-pyrazol-3-yl)-6-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | 2-[2-fluoro-4-[2-(2-fluoro-3-nitrophenyl)ethynyl]phenyl]sulfanyl-5-methoxy-N-(5-methyl-1H-pyrazol-3-yl)-6-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 122625472 |
| Molecular Formula | C27H23F2N7O4S |
| Molecular Weight | 579.59 g/mol |
| Exact Mass | 579.15 |
| IUPAC Name | 2-[2-fluoro-4-[2-(2-fluoro-3-nitrophenyl)ethynyl]phenyl]sulfanyl-5-methoxy-N-(5-methyl-1H-pyrazol-3-yl)-6-morpholin-4-ylpyrimidin-4-amine |
| SMILES | COc1c(Nc2cc(C)[nH]n2)nc(Sc2ccc(C#Cc3cccc([N+](=O)[O-])c3F)cc2F)nc1N1CCOCC1 |
| InChI | InChI=1S/C27H23F2N7O4S/c1-16-14-22(34-33-16)30-25-24(39-2)26(35-10-12-40-13-11-35)32-27(31-25)41-21-9-7-17(15-19(21)28)6-8-18-4-3-5-20(23(18)29)36(37)38/h3-5,7,9,14-15H,10-13H2,1-2H3,(H2,30,31,32,33,34) |
| InChIKey | LQFOQTUPHHFETA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 131.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|