C24H32N6O2 — CID 122626099
N-[5-[(8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]-6-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]-4-ethylbenzamide (PubChem CID 122626099) has the molecular formula C24H32N6O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is N-[5-[(8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]-6-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]-4-ethylbenzamide.
| Compound Name | N-[5-[(8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]-6-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]-4-ethylbenzamide |
|---|---|
| PubChem CID | 122626099 |
| Molecular Formula | C24H32N6O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | N-[5-[(8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]-6-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]-4-ethylbenzamide |
| SMILES | CCc1ccc(C(=O)Nc2n[nH]c3c2CN(C(=O)N2C[C@@H]4CCCN4CC2C)C3C)cc1 |
| InChI | InChI=1S/C24H32N6O2/c1-4-17-7-9-18(10-8-17)23(31)25-22-20-14-30(16(3)21(20)26-27-22)24(32)29-13-19-6-5-11-28(19)12-15(29)2/h7-10,15-16,19H,4-6,11-14H2,1-3H3,(H2,25,26,27,31)/t15?,16?,19-/m0/s1 |
| InChIKey | LNCJXGASZKEQCO-RJYAGPCLSA-N |
| XLogP | 3.39 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |