C24H35N3O5 — CID 122626450
(1S,4R,6S,7Z,11R,13R)-N-(3-cyclopropyldioxiran-3-yl)-11,13-dimethyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide (PubChem CID 122626450) has the molecular formula C24H35N3O5 and a molecular weight of 445.56 g/mol. Its IUPAC name is (1S,4R,6S,7Z,11R,13R)-N-(3-cyclopropyldioxiran-3-yl)-11,13-dimethyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide.
| Compound Name | (1S,4R,6S,7Z,11R,13R)-N-(3-cyclopropyldioxiran-3-yl)-11,13-dimethyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide |
|---|---|
| PubChem CID | 122626450 |
| Molecular Formula | C24H35N3O5 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | (1S,4R,6S,7Z,11R,13R)-N-(3-cyclopropyldioxiran-3-yl)-11,13-dimethyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide |
| SMILES | C[C@@H]1CC/C=C\[C@@H]2C[C@@]2(C(=O)NC2(C3CC3)OO2)NC(=O)[C@@H]2CCCN2C(=O)C[C@H](C)C1 |
| InChI | InChI=1S/C24H35N3O5/c1-15-6-3-4-7-18-14-23(18,22(30)26-24(31-32-24)17-9-10-17)25-21(29)19-8-5-11-27(19)20(28)13-16(2)12-15/h4,7,15-19H,3,5-6,8-14H2,1-2H3,(H,25,29)(H,26,30)/b7-4-/t15-,16-,18-,19+,23-/m1/s1 |
| InChIKey | DRNJGBPEYCKNBH-SKGZQXDRSA-N |
| XLogP | 2.40 |
| TPSA | 103.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|