C24H38N4O5S — CID 123528557
14-amino-N-cyclobutylsulfonyl-11,13-dimethyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide (PubChem CID 123528557) has the molecular formula C24H38N4O5S and a molecular weight of 494.66 g/mol. Its IUPAC name is 14-amino-N-cyclobutylsulfonyl-11,13-dimethyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide.
| Compound Name | 14-amino-N-cyclobutylsulfonyl-11,13-dimethyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide |
|---|---|
| PubChem CID | 123528557 |
| Molecular Formula | C24H38N4O5S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | 14-amino-N-cyclobutylsulfonyl-11,13-dimethyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide |
| SMILES | CC1CCC=CC2CC2(C(=O)NS(=O)(=O)C2CCC2)NC(=O)C2CCCN2C(=O)C(N)C(C)C1 |
| InChI | InChI=1S/C24H38N4O5S/c1-15-7-3-4-8-17-14-24(17,23(31)27-34(32,33)18-9-5-10-18)26-21(29)19-11-6-12-28(19)22(30)20(25)16(2)13-15/h4,8,15-20H,3,5-7,9-14,25H2,1-2H3,(H,26,29)(H,27,31) |
| InChIKey | LYFZCNOTJBZLRI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|