C28H44N4O7S — CID 58828375
tert-butyl N-[(1S,4R,6R,7Z)-4-(cyclopropylsulfonylcarbamoyl)-2,17-dioxo-3,18-diazatricyclo[16.3.0.04,6]henicos-7-en-16-yl]carbamate (PubChem CID 58828375) has the molecular formula C28H44N4O7S and a molecular weight of 580.75 g/mol. Its IUPAC name is tert-butyl N-[(1S,4R,6R,7Z)-4-(cyclopropylsulfonylcarbamoyl)-2,17-dioxo-3,18-diazatricyclo[16.3.0.04,6]henicos-7-en-16-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,4R,6R,7Z)-4-(cyclopropylsulfonylcarbamoyl)-2,17-dioxo-3,18-diazatricyclo[16.3.0.04,6]henicos-7-en-16-yl]carbamate |
|---|---|
| PubChem CID | 58828375 |
| Molecular Formula | C28H44N4O7S |
| Molecular Weight | 580.75 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | tert-butyl N-[(1S,4R,6R,7Z)-4-(cyclopropylsulfonylcarbamoyl)-2,17-dioxo-3,18-diazatricyclo[16.3.0.04,6]henicos-7-en-16-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCCCCC/C=C\[C@H]2C[C@@]2(C(=O)NS(=O)(=O)C2CC2)NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C28H44N4O7S/c1-27(2,3)39-26(36)29-21-13-10-8-6-4-5-7-9-12-19-18-28(19,25(35)31-40(37,38)20-15-16-20)30-23(33)22-14-11-17-32(22)24(21)34/h9,12,19-22H,4-8,10-11,13-18H2,1-3H3,(H,29,36)(H,30,33)(H,31,35)/b12-9-/t19-,21?,22-,28+/m0/s1 |
| InChIKey | WWQPBZSUZHRIAJ-WVSRZMFGSA-N |
| XLogP | 2.65 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.75 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|