C27H43N5O7S — CID 90838619
tert-butyl N-[(1S,4R,6S,14S)-4-[[methyl(prop-2-enyl)sulfamoyl]carbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate (PubChem CID 90838619) has the molecular formula C27H43N5O7S and a molecular weight of 581.74 g/mol. Its IUPAC name is tert-butyl N-[(1S,4R,6S,14S)-4-[[methyl(prop-2-enyl)sulfamoyl]carbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,4R,6S,14S)-4-[[methyl(prop-2-enyl)sulfamoyl]carbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
|---|---|
| PubChem CID | 90838619 |
| Molecular Formula | C27H43N5O7S |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 581.29 |
| IUPAC Name | tert-butyl N-[(1S,4R,6S,14S)-4-[[methyl(prop-2-enyl)sulfamoyl]carbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
| SMILES | C=CCN(C)S(=O)(=O)NC(=O)[C@@]12C[C@H]1C=CCCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N1CCC[C@H]1C(=O)N2 |
| InChI | InChI=1S/C27H43N5O7S/c1-6-16-31(5)40(37,38)30-24(35)27-18-19(27)13-10-8-7-9-11-14-20(28-25(36)39-26(2,3)4)23(34)32-17-12-15-21(32)22(33)29-27/h6,10,13,19-21H,1,7-9,11-12,14-18H2,2-5H3,(H,28,36)(H,29,33)(H,30,35)/t19-,20+,21+,27-/m1/s1 |
| InChIKey | WEVANYNHHAWACA-MYCJUQKNSA-N |
| XLogP | 1.74 |
| TPSA | 154.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|