C27H44N4O7S — CID 91256053
tert-butyl N-[(1S,4R,6S,14S)-4-(tert-butylsulfonylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate (PubChem CID 91256053) has the molecular formula C27H44N4O7S and a molecular weight of 568.74 g/mol. Its IUPAC name is tert-butyl N-[(1S,4R,6S,14S)-4-(tert-butylsulfonylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,4R,6S,14S)-4-(tert-butylsulfonylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
|---|---|
| PubChem CID | 91256053 |
| Molecular Formula | C27H44N4O7S |
| Molecular Weight | 568.74 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | tert-butyl N-[(1S,4R,6S,14S)-4-(tert-butylsulfonylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCCCC=C[C@@H]2C[C@@]2(C(=O)NS(=O)(=O)C(C)(C)C)NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C27H44N4O7S/c1-25(2,3)38-24(35)28-19-14-11-9-7-8-10-13-18-17-27(18,23(34)30-39(36,37)26(4,5)6)29-21(32)20-15-12-16-31(20)22(19)33/h10,13,18-20H,7-9,11-12,14-17H2,1-6H3,(H,28,35)(H,29,32)(H,30,34)/t18-,19+,20+,27-/m1/s1 |
| InChIKey | RZNLJQDAKLNVKM-NGXOIDRJSA-N |
| XLogP | 2.51 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.74 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|