C33H41ClN4O7S — CID 91111527
tert-butyl N-[(1S,4R,6S,14S)-4-[(5-chloronaphthalen-1-yl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate (PubChem CID 91111527) has the molecular formula C33H41ClN4O7S and a molecular weight of 673.23 g/mol. Its IUPAC name is tert-butyl N-[(1S,4R,6S,14S)-4-[(5-chloronaphthalen-1-yl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,4R,6S,14S)-4-[(5-chloronaphthalen-1-yl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
|---|---|
| PubChem CID | 91111527 |
| Molecular Formula | C33H41ClN4O7S |
| Molecular Weight | 673.23 g/mol |
| Exact Mass | 672.24 |
| IUPAC Name | tert-butyl N-[(1S,4R,6S,14S)-4-[(5-chloronaphthalen-1-yl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCCCC=C[C@@H]2C[C@@]2(C(=O)NS(=O)(=O)c2cccc3c(Cl)cccc23)NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C33H41ClN4O7S/c1-32(2,3)45-31(42)35-25-16-8-6-4-5-7-12-21-20-33(21,36-28(39)26-17-11-19-38(26)29(25)40)30(41)37-46(43,44)27-18-10-13-22-23(27)14-9-15-24(22)34/h7,9-10,12-15,18,21,25-26H,4-6,8,11,16-17,19-20H2,1-3H3,(H,35,42)(H,36,39)(H,37,41)/t21-,25+,26+,33-/m1/s1 |
| InChIKey | WMPCEESNOKLMMU-KIJYWCJHSA-N |
| XLogP | 4.58 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.23 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|