C29H39ClN4O7S — CID 90975849
tert-butyl N-[(1S,4R,6S,14S)-4-[(3-chlorophenyl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate (PubChem CID 90975849) has the molecular formula C29H39ClN4O7S and a molecular weight of 623.17 g/mol. Its IUPAC name is tert-butyl N-[(1S,4R,6S,14S)-4-[(3-chlorophenyl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,4R,6S,14S)-4-[(3-chlorophenyl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
|---|---|
| PubChem CID | 90975849 |
| Molecular Formula | C29H39ClN4O7S |
| Molecular Weight | 623.17 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | tert-butyl N-[(1S,4R,6S,14S)-4-[(3-chlorophenyl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCCCC=C[C@@H]2C[C@@]2(C(=O)NS(=O)(=O)c2cccc(Cl)c2)NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C29H39ClN4O7S/c1-28(2,3)41-27(38)31-22-14-8-6-4-5-7-11-19-18-29(19,32-24(35)23-15-10-16-34(23)25(22)36)26(37)33-42(39,40)21-13-9-12-20(30)17-21/h7,9,11-13,17,19,22-23H,4-6,8,10,14-16,18H2,1-3H3,(H,31,38)(H,32,35)(H,33,37)/t19-,22+,23+,29-/m1/s1 |
| InChIKey | VFMVLJNOZYFKDL-WBEVNYFSSA-N |
| XLogP | 3.42 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.17 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|