C31H45N5O7S — CID 70826721
tert-butyl N-[(1S,4R,6S,7Z,14S)-4-[[benzyl(methyl)sulfamoyl]carbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate (PubChem CID 70826721) has the molecular formula C31H45N5O7S and a molecular weight of 631.80 g/mol. Its IUPAC name is tert-butyl N-[(1S,4R,6S,7Z,14S)-4-[[benzyl(methyl)sulfamoyl]carbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,4R,6S,7Z,14S)-4-[[benzyl(methyl)sulfamoyl]carbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
|---|---|
| PubChem CID | 70826721 |
| Molecular Formula | C31H45N5O7S |
| Molecular Weight | 631.80 g/mol |
| Exact Mass | 631.30 |
| IUPAC Name | tert-butyl N-[(1S,4R,6S,7Z,14S)-4-[[benzyl(methyl)sulfamoyl]carbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)NC(=O)[C@@]12C[C@H]1/C=C\CCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N1CCC[C@H]1C(=O)N2 |
| InChI | InChI=1S/C31H45N5O7S/c1-30(2,3)43-29(40)32-24-17-12-7-5-6-11-16-23-20-31(23,33-26(37)25-18-13-19-36(25)27(24)38)28(39)34-44(41,42)35(4)21-22-14-9-8-10-15-22/h8-11,14-16,23-25H,5-7,12-13,17-21H2,1-4H3,(H,32,40)(H,33,37)(H,34,39)/b16-11-/t23-,24+,25+,31-/m1/s1 |
| InChIKey | AJUMAEJQJHLJOH-AZUDTXJHSA-N |
| XLogP | 2.76 |
| TPSA | 154.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.80 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|