C28H45N5O7S — CID 70826806
tert-butyl N-[(1S,4R,6S,7Z)-4-(cyclopentylsulfamoylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate (PubChem CID 70826806) has the molecular formula C28H45N5O7S and a molecular weight of 595.76 g/mol. Its IUPAC name is tert-butyl N-[(1S,4R,6S,7Z)-4-(cyclopentylsulfamoylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,4R,6S,7Z)-4-(cyclopentylsulfamoylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
|---|---|
| PubChem CID | 70826806 |
| Molecular Formula | C28H45N5O7S |
| Molecular Weight | 595.76 g/mol |
| Exact Mass | 595.30 |
| IUPAC Name | tert-butyl N-[(1S,4R,6S,7Z)-4-(cyclopentylsulfamoylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCCC/C=C\[C@@H]2C[C@@]2(C(=O)NS(=O)(=O)NC2CCCC2)NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C28H45N5O7S/c1-27(2,3)40-26(37)29-21-15-8-6-4-5-7-12-19-18-28(19,30-23(34)22-16-11-17-33(22)24(21)35)25(36)32-41(38,39)31-20-13-9-10-14-20/h7,12,19-22,31H,4-6,8-11,13-18H2,1-3H3,(H,29,37)(H,30,34)(H,32,36)/b12-7-/t19-,21?,22+,28-/m1/s1 |
| InChIKey | DNWFZIYBVVXINK-QOJJGOQOSA-N |
| XLogP | 2.16 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.76 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|