C35H47N5O7S — CID 59554520
tert-butyl N-[(1S,4R,6R,7Z,14S)-4-(2-naphthalen-2-ylethylsulfamoylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate (PubChem CID 59554520) has the molecular formula C35H47N5O7S and a molecular weight of 681.86 g/mol. Its IUPAC name is tert-butyl N-[(1S,4R,6R,7Z,14S)-4-(2-naphthalen-2-ylethylsulfamoylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,4R,6R,7Z,14S)-4-(2-naphthalen-2-ylethylsulfamoylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
|---|---|
| PubChem CID | 59554520 |
| Molecular Formula | C35H47N5O7S |
| Molecular Weight | 681.86 g/mol |
| Exact Mass | 681.32 |
| IUPAC Name | tert-butyl N-[(1S,4R,6R,7Z,14S)-4-(2-naphthalen-2-ylethylsulfamoylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCCC/C=C\[C@H]2C[C@@]2(C(=O)NS(=O)(=O)NCCc2ccc3ccccc3c2)NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C35H47N5O7S/c1-34(2,3)47-33(44)37-28-15-8-6-4-5-7-14-27-23-35(27,38-30(41)29-16-11-21-40(29)31(28)42)32(43)39-48(45,46)36-20-19-24-17-18-25-12-9-10-13-26(25)22-24/h7,9-10,12-14,17-18,22,27-29,36H,4-6,8,11,15-16,19-21,23H2,1-3H3,(H,37,44)(H,38,41)(H,39,43)/b14-7-/t27-,28-,29-,35+/m0/s1 |
| InChIKey | RLLQGVPLHBLSGO-WZGQKJLRSA-N |
| XLogP | 3.61 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.86 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|