C30H42N4O8S — CID 91409168
tert-butyl N-[(1S,4R,6S,14S)-4-[(2-methoxyphenyl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate (PubChem CID 91409168) has the molecular formula C30H42N4O8S and a molecular weight of 618.75 g/mol. Its IUPAC name is tert-butyl N-[(1S,4R,6S,14S)-4-[(2-methoxyphenyl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,4R,6S,14S)-4-[(2-methoxyphenyl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
|---|---|
| PubChem CID | 91409168 |
| Molecular Formula | C30H42N4O8S |
| Molecular Weight | 618.75 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | tert-butyl N-[(1S,4R,6S,14S)-4-[(2-methoxyphenyl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
| SMILES | COc1ccccc1S(=O)(=O)NC(=O)[C@@]12C[C@H]1C=CCCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N1CCC[C@H]1C(=O)N2 |
| InChI | InChI=1S/C30H42N4O8S/c1-29(2,3)42-28(38)31-21-14-9-7-5-6-8-13-20-19-30(20,32-25(35)22-15-12-18-34(22)26(21)36)27(37)33-43(39,40)24-17-11-10-16-23(24)41-4/h8,10-11,13,16-17,20-22H,5-7,9,12,14-15,18-19H2,1-4H3,(H,31,38)(H,32,35)(H,33,37)/t20-,21+,22+,30-/m1/s1 |
| InChIKey | SDGIGRNVIUDOAA-DOFLNCLYSA-N |
| XLogP | 2.78 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.75 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|