C31H44N4O7S — CID 58828299
tert-butyl N-[(1S,4R,6R,7Z)-4-(benzenesulfonylcarbamoyl)-2,17-dioxo-3,18-diazatricyclo[16.3.0.04,6]henicos-7-en-16-yl]carbamate (PubChem CID 58828299) has the molecular formula C31H44N4O7S and a molecular weight of 616.78 g/mol. Its IUPAC name is tert-butyl N-[(1S,4R,6R,7Z)-4-(benzenesulfonylcarbamoyl)-2,17-dioxo-3,18-diazatricyclo[16.3.0.04,6]henicos-7-en-16-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,4R,6R,7Z)-4-(benzenesulfonylcarbamoyl)-2,17-dioxo-3,18-diazatricyclo[16.3.0.04,6]henicos-7-en-16-yl]carbamate |
|---|---|
| PubChem CID | 58828299 |
| Molecular Formula | C31H44N4O7S |
| Molecular Weight | 616.78 g/mol |
| Exact Mass | 616.29 |
| IUPAC Name | tert-butyl N-[(1S,4R,6R,7Z)-4-(benzenesulfonylcarbamoyl)-2,17-dioxo-3,18-diazatricyclo[16.3.0.04,6]henicos-7-en-16-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCCCCC/C=C\[C@H]2C[C@@]2(C(=O)NS(=O)(=O)c2ccccc2)NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C31H44N4O7S/c1-30(2,3)42-29(39)32-24-18-13-8-6-4-5-7-10-15-22-21-31(22,33-26(36)25-19-14-20-35(25)27(24)37)28(38)34-43(40,41)23-16-11-9-12-17-23/h9-12,15-17,22,24-25H,4-8,13-14,18-21H2,1-3H3,(H,32,39)(H,33,36)(H,34,38)/b15-10-/t22-,24?,25-,31+/m0/s1 |
| InChIKey | MZFPLYPORSCXFW-IVIUEEFJSA-N |
| XLogP | 3.55 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.78 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|