C28H28F6N2O — CID 122627048
(2R)-1,1,1-trifluoro-3-[4-(1,2,3,4-tetrahydronaphthalen-1-yl)-2-[3-(trifluoromethyl)phenyl]-2,3,6,7-tetrahydroquinoxalin-1-yl]propan-2-ol (PubChem CID 122627048) has the molecular formula C28H28F6N2O and a molecular weight of 522.53 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-3-[4-(1,2,3,4-tetrahydronaphthalen-1-yl)-2-[3-(trifluoromethyl)phenyl]-2,3,6,7-tetrahydroquinoxalin-1-yl]propan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-3-[4-(1,2,3,4-tetrahydronaphthalen-1-yl)-2-[3-(trifluoromethyl)phenyl]-2,3,6,7-tetrahydroquinoxalin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 122627048 |
| Molecular Formula | C28H28F6N2O |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | (2R)-1,1,1-trifluoro-3-[4-(1,2,3,4-tetrahydronaphthalen-1-yl)-2-[3-(trifluoromethyl)phenyl]-2,3,6,7-tetrahydroquinoxalin-1-yl]propan-2-ol |
| SMILES | O[C@H](CN1C2=CCCC=C2N(C2CCCc3ccccc32)CC1c1cccc(C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C28H28F6N2O/c29-27(30,31)20-10-5-9-19(15-20)25-16-35(22-14-6-8-18-7-1-2-11-21(18)22)23-12-3-4-13-24(23)36(25)17-26(37)28(32,33)34/h1-2,5,7,9-13,15,22,25-26,37H,3-4,6,8,14,16-17H2/t22?,25?,26-/m1/s1 |
| InChIKey | UKGRVBXBIXQDAV-TXDAUAKNSA-N |
| XLogP | 6.93 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |