C22H17FN2OS — CID 122631381
3,4-dihydro-1H-isoquinolin-2-yl-[2-fluoro-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]phenyl]methanone (PubChem CID 122631381) has the molecular formula C22H17FN2OS and a molecular weight of 376.46 g/mol. Its IUPAC name is 3,4-dihydro-1H-isoquinolin-2-yl-[2-fluoro-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]phenyl]methanone.
| Compound Name | 3,4-dihydro-1H-isoquinolin-2-yl-[2-fluoro-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]phenyl]methanone |
|---|---|
| PubChem CID | 122631381 |
| Molecular Formula | C22H17FN2OS |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 3,4-dihydro-1H-isoquinolin-2-yl-[2-fluoro-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]phenyl]methanone |
| SMILES | Cc1nc(C#Cc2ccc(F)c(C(=O)N3CCc4ccccc4C3)c2)cs1 |
| InChI | InChI=1S/C22H17FN2OS/c1-15-24-19(14-27-15)8-6-16-7-9-21(23)20(12-16)22(26)25-11-10-17-4-2-3-5-18(17)13-25/h2-5,7,9,12,14H,10-11,13H2,1H3 |
| InChIKey | MOGIDNXQKFRXCZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|