C13H19F3O2 — CID 122631413
3-[difluoro(3-fluoropropoxy)methyl]-3-ethenoxyhepta-1,6-diene (PubChem CID 122631413) has the molecular formula C13H19F3O2 and a molecular weight of 264.29 g/mol. Its IUPAC name is 3-[difluoro(3-fluoropropoxy)methyl]-3-ethenoxyhepta-1,6-diene.
| Compound Name | 3-[difluoro(3-fluoropropoxy)methyl]-3-ethenoxyhepta-1,6-diene |
|---|---|
| PubChem CID | 122631413 |
| Molecular Formula | C13H19F3O2 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 3-[difluoro(3-fluoropropoxy)methyl]-3-ethenoxyhepta-1,6-diene |
| SMILES | C=CCCC(C=C)(OC=C)C(F)(F)OCCCF |
| InChI | InChI=1S/C13H19F3O2/c1-4-7-9-12(5-2,17-6-3)13(15,16)18-11-8-10-14/h4-6H,1-3,7-11H2 |
| InChIKey | AITJZNIWZCURNH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|