About 4-[1,1-difluoro-3-(trifluoromethoxy)propyl]octa-1,7-dien-4-ol
4-[1,1-difluoro-3-(trifluoromethoxy)propyl]octa-1,7-dien-4-ol (PubChem CID 161288540) has the molecular formula C12H17F5O2
and a molecular weight of 288.26 g/mol. Its IUPAC name is 4-[1,1-difluoro-3-(trifluoromethoxy)propyl]octa-1,7-dien-4-ol.
Molecular Properties
| Compound Name | 4-[1,1-difluoro-3-(trifluoromethoxy)propyl]octa-1,7-dien-4-ol |
| PubChem CID | 161288540 |
| Molecular Formula | C12H17F5O2 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 4-[1,1-difluoro-3-(trifluoromethoxy)propyl]octa-1,7-dien-4-ol |
| SMILES | C=CCCC(O)(CC=C)C(F)(F)CCOC(F)(F)F |
| InChI | InChI=1S/C12H17F5O2/c1-3-5-7-10(18,6-4-2)11(13,14)8-9-19-12(15,16)17/h3-4,18H,1-2,5-9H2 |
| InChIKey | MPJWJISBQQNGRN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[1,1-difluoro-3-(trifluoromethoxy)propyl]octa-1,7-dien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1,1-difluoro-3-(trifluoromethoxy)propyl]octa-1,7-dien-4-ol?
The IUPAC name of 4-[1,1-difluoro-3-(trifluoromethoxy)propyl]octa-1,7-dien-4-ol (CID 161288540) is 4-[1,1-difluoro-3-(trifluoromethoxy)propyl]octa-1,7-dien-4-ol.
What is the SMILES notation for 4-[1,1-difluoro-3-(trifluoromethoxy)propyl]octa-1,7-dien-4-ol?
The canonical SMILES for 4-[1,1-difluoro-3-(trifluoromethoxy)propyl]octa-1,7-dien-4-ol is C=CCCC(O)(CC=C)C(F)(F)CCOC(F)(F)F.
What is the InChIKey of 4-[1,1-difluoro-3-(trifluoromethoxy)propyl]octa-1,7-dien-4-ol?
The InChIKey is MPJWJISBQQNGRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F5O2/c1-3-5-7-10(18,6-4-2)11(13,14)8-9-19-12(15,16)17/h3-4,18H,1-2,5-9H2.
What are the key properties of 4-[1,1-difluoro-3-(trifluoromethoxy)propyl]octa-1,7-dien-4-ol?
4-[1,1-difluoro-3-(trifluoromethoxy)propyl]octa-1,7-dien-4-ol has a molecular weight of 288.26 g/mol, XLogP of 3.82, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1,1-difluoro-3-(trifluoromethoxy)propyl]octa-1,7-dien-4-ol is sourced from PubChem (CID 161288540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).