C12H17F5O2 — CID 161288540
4-[1,1-difluoro-3-(trifluoromethoxy)propyl]octa-1,7-dien-4-ol (PubChem CID 161288540) has the molecular formula C12H17F5O2 and a molecular weight of 288.26 g/mol. Its IUPAC name is 4-[1,1-difluoro-3-(trifluoromethoxy)propyl]octa-1,7-dien-4-ol.
| Compound Name | 4-[1,1-difluoro-3-(trifluoromethoxy)propyl]octa-1,7-dien-4-ol |
|---|---|
| PubChem CID | 161288540 |
| Molecular Formula | C12H17F5O2 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 4-[1,1-difluoro-3-(trifluoromethoxy)propyl]octa-1,7-dien-4-ol |
| SMILES | C=CCCC(O)(CC=C)C(F)(F)CCOC(F)(F)F |
| InChI | InChI=1S/C12H17F5O2/c1-3-5-7-10(18,6-4-2)11(13,14)8-9-19-12(15,16)17/h3-4,18H,1-2,5-9H2 |
| InChIKey | MPJWJISBQQNGRN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|