C20H28F9NO2 — CID 159419758
N-[2,2-bis(prop-2-enyl)pent-4-enyl]acetamide;3,3,4,4,5,5-hexafluoro-1-(trifluoromethoxy)hexane (PubChem CID 159419758) has the molecular formula C20H28F9NO2 and a molecular weight of 485.43 g/mol. Its IUPAC name is N-[2,2-bis(prop-2-enyl)pent-4-enyl]acetamide;3,3,4,4,5,5-hexafluoro-1-(trifluoromethoxy)hexane.
| Compound Name | N-[2,2-bis(prop-2-enyl)pent-4-enyl]acetamide;3,3,4,4,5,5-hexafluoro-1-(trifluoromethoxy)hexane |
|---|---|
| PubChem CID | 159419758 |
| Molecular Formula | C20H28F9NO2 |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-[2,2-bis(prop-2-enyl)pent-4-enyl]acetamide;3,3,4,4,5,5-hexafluoro-1-(trifluoromethoxy)hexane |
| SMILES | C=CCC(CC=C)(CC=C)CNC(C)=O.CC(F)(F)C(F)(F)C(F)(F)CCOC(F)(F)F |
| InChI | InChI=1S/C13H21NO.C7H7F9O/c1-5-8-13(9-6-2,10-7-3)11-14-12(4)15;1-4(8,9)6(12,13)5(10,11)2-3-17-7(14,15)16/h5-7H,1-3,8-11H2,4H3,(H,14,15);2-3H2,1H3 |
| InChIKey | LPPQPMSMPVUORS-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|