C20H31F9OSi — CID 157231509
3,3,4,4,5,5-hexafluoro-1-(trifluoromethoxy)hexane;hex-5-en-3-yl-methyl-bis(prop-2-enyl)silane (PubChem CID 157231509) has the molecular formula C20H31F9OSi and a molecular weight of 486.54 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1-(trifluoromethoxy)hexane;hex-5-en-3-yl-methyl-bis(prop-2-enyl)silane.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1-(trifluoromethoxy)hexane;hex-5-en-3-yl-methyl-bis(prop-2-enyl)silane |
|---|---|
| PubChem CID | 157231509 |
| Molecular Formula | C20H31F9OSi |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1-(trifluoromethoxy)hexane;hex-5-en-3-yl-methyl-bis(prop-2-enyl)silane |
| SMILES | C=CCC(CC)[Si](C)(CC=C)CC=C.CC(F)(F)C(F)(F)C(F)(F)CCOC(F)(F)F |
| InChI | InChI=1S/C13H24Si.C7H7F9O/c1-6-10-13(9-4)14(5,11-7-2)12-8-3;1-4(8,9)6(12,13)5(10,11)2-3-17-7(14,15)16/h6-8,13H,1-3,9-12H2,4-5H3;2-3H2,1H3 |
| InChIKey | AUDSLPNBOLTITP-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|