C15H14F19OP — CID 143018723
(1-ethoxy-3,3,4,4,5,5,6,6,7,8,8,9,9,10,10,11,11,12,12-nonadecafluorotridecan-7-yl)phosphane (PubChem CID 143018723) has the molecular formula C15H14F19OP and a molecular weight of 602.21 g/mol. Its IUPAC name is (1-ethoxy-3,3,4,4,5,5,6,6,7,8,8,9,9,10,10,11,11,12,12-nonadecafluorotridecan-7-yl)phosphane.
| Compound Name | (1-ethoxy-3,3,4,4,5,5,6,6,7,8,8,9,9,10,10,11,11,12,12-nonadecafluorotridecan-7-yl)phosphane |
|---|---|
| PubChem CID | 143018723 |
| Molecular Formula | C15H14F19OP |
| Molecular Weight | 602.21 g/mol |
| Exact Mass | 602.05 |
| IUPAC Name | (1-ethoxy-3,3,4,4,5,5,6,6,7,8,8,9,9,10,10,11,11,12,12-nonadecafluorotridecan-7-yl)phosphane |
| SMILES | CCOCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(P)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C15H14F19OP/c1-3-35-5-4-7(18,19)9(22,23)11(26,27)13(30,31)15(34,36)14(32,33)12(28,29)10(24,25)8(20,21)6(2,16)17/h3-5,36H2,1-2H3 |
| InChIKey | ACDLNPJBERUZKN-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.21 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|