C29H61F9O10Si4 — CID 161229551
3,3,4,4,5,5-hexafluoro-1-(trifluoromethoxy)hexane;trimethoxy-[4-[methyl-bis(3-trimethoxysilylpropyl)silyl]hexyl]silane (PubChem CID 161229551) has the molecular formula C29H61F9O10Si4 and a molecular weight of 853.12 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1-(trifluoromethoxy)hexane;trimethoxy-[4-[methyl-bis(3-trimethoxysilylpropyl)silyl]hexyl]silane.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1-(trifluoromethoxy)hexane;trimethoxy-[4-[methyl-bis(3-trimethoxysilylpropyl)silyl]hexyl]silane |
|---|---|
| PubChem CID | 161229551 |
| Molecular Formula | C29H61F9O10Si4 |
| Molecular Weight | 853.12 g/mol |
| Exact Mass | 852.32 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1-(trifluoromethoxy)hexane;trimethoxy-[4-[methyl-bis(3-trimethoxysilylpropyl)silyl]hexyl]silane |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)CCOC(F)(F)F.CCC(CCC[Si](OC)(OC)OC)[Si](C)(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C22H54O9Si4.C7H7F9O/c1-12-22(16-13-19-33(23-2,24-3)25-4)32(11,17-14-20-34(26-5,27-6)28-7)18-15-21-35(29-8,30-9)31-10;1-4(8,9)6(12,13)5(10,11)2-3-17-7(14,15)16/h22H,12-21H2,1-11H3;2-3H2,1H3 |
| InChIKey | UYOMVLAFMRMYRD-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.12 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|