C28H56O3Si3 — CID 155609338
[4-[dimethyl(3-trimethoxysilylpropyl)silyl]phenyl]-dodecan-3-yl-dimethylsilane (PubChem CID 155609338) has the molecular formula C28H56O3Si3 and a molecular weight of 525.01 g/mol. Its IUPAC name is [4-[dimethyl(3-trimethoxysilylpropyl)silyl]phenyl]-dodecan-3-yl-dimethylsilane.
| Compound Name | [4-[dimethyl(3-trimethoxysilylpropyl)silyl]phenyl]-dodecan-3-yl-dimethylsilane |
|---|---|
| PubChem CID | 155609338 |
| Molecular Formula | C28H56O3Si3 |
| Molecular Weight | 525.01 g/mol |
| Exact Mass | 524.35 |
| IUPAC Name | [4-[dimethyl(3-trimethoxysilylpropyl)silyl]phenyl]-dodecan-3-yl-dimethylsilane |
| SMILES | CCCCCCCCCC(CC)[Si](C)(C)c1ccc([Si](C)(C)CCC[Si](OC)(OC)OC)cc1 |
| InChI | InChI=1S/C28H56O3Si3/c1-10-12-13-14-15-16-17-19-26(11-2)33(8,9)28-22-20-27(21-23-28)32(6,7)24-18-25-34(29-3,30-4)31-5/h20-23,26H,10-19,24-25H2,1-9H3 |
| InChIKey | GWJRUHHPUOXFRD-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.01 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|