C17H34O3Si3 — CID 156627225
dimethyl-(3-trimethoxysilylpropyl)-(4-trimethylsilylphenyl)silane (PubChem CID 156627225) has the molecular formula C17H34O3Si3 and a molecular weight of 370.71 g/mol. Its IUPAC name is dimethyl-(3-trimethoxysilylpropyl)-(4-trimethylsilylphenyl)silane.
| Compound Name | dimethyl-(3-trimethoxysilylpropyl)-(4-trimethylsilylphenyl)silane |
|---|---|
| PubChem CID | 156627225 |
| Molecular Formula | C17H34O3Si3 |
| Molecular Weight | 370.71 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | dimethyl-(3-trimethoxysilylpropyl)-(4-trimethylsilylphenyl)silane |
| SMILES | CO[Si](CCC[Si](C)(C)c1ccc([Si](C)(C)C)cc1)(OC)OC |
| InChI | InChI=1S/C17H34O3Si3/c1-18-23(19-2,20-3)15-9-14-22(7,8)17-12-10-16(11-13-17)21(4,5)6/h10-13H,9,14-15H2,1-8H3 |
| InChIKey | YBITZJHIWYBMIW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.71 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|