C27H54O3Si3 — CID 155609345
[4-[dimethyl(2-trimethoxysilylethyl)silyl]phenyl]-dodecan-3-yl-dimethylsilane (PubChem CID 155609345) has the molecular formula C27H54O3Si3 and a molecular weight of 510.98 g/mol. Its IUPAC name is [4-[dimethyl(2-trimethoxysilylethyl)silyl]phenyl]-dodecan-3-yl-dimethylsilane.
| Compound Name | [4-[dimethyl(2-trimethoxysilylethyl)silyl]phenyl]-dodecan-3-yl-dimethylsilane |
|---|---|
| PubChem CID | 155609345 |
| Molecular Formula | C27H54O3Si3 |
| Molecular Weight | 510.98 g/mol |
| Exact Mass | 510.34 |
| IUPAC Name | [4-[dimethyl(2-trimethoxysilylethyl)silyl]phenyl]-dodecan-3-yl-dimethylsilane |
| SMILES | CCCCCCCCCC(CC)[Si](C)(C)c1ccc([Si](C)(C)CC[Si](OC)(OC)OC)cc1 |
| InChI | InChI=1S/C27H54O3Si3/c1-10-12-13-14-15-16-17-18-25(11-2)32(8,9)27-21-19-26(20-22-27)31(6,7)23-24-33(28-3,29-4)30-5/h19-22,25H,10-18,23-24H2,1-9H3 |
| InChIKey | BNZNJQBELKCMGC-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.98 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|