C11H16Cl2F9IOSi — CID 157466502
dichloro-(1-iodopropyl)-methylsilane;3,3,4,4,5,5-hexafluoro-1-(trifluoromethoxy)hexane (PubChem CID 157466502) has the molecular formula C11H16Cl2F9IOSi and a molecular weight of 561.13 g/mol. Its IUPAC name is dichloro-(1-iodopropyl)-methylsilane;3,3,4,4,5,5-hexafluoro-1-(trifluoromethoxy)hexane.
| Compound Name | dichloro-(1-iodopropyl)-methylsilane;3,3,4,4,5,5-hexafluoro-1-(trifluoromethoxy)hexane |
|---|---|
| PubChem CID | 157466502 |
| Molecular Formula | C11H16Cl2F9IOSi |
| Molecular Weight | 561.13 g/mol |
| Exact Mass | 559.92 |
| IUPAC Name | dichloro-(1-iodopropyl)-methylsilane;3,3,4,4,5,5-hexafluoro-1-(trifluoromethoxy)hexane |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)CCOC(F)(F)F.CCC(I)[Si](C)(Cl)Cl |
| InChI | InChI=1S/C7H7F9O.C4H9Cl2ISi/c1-4(8,9)6(12,13)5(10,11)2-3-17-7(14,15)16;1-3-4(7)8(2,5)6/h2-3H2,1H3;4H,3H2,1-2H3 |
| InChIKey | BUNSFDMYXVNTEI-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.13 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|