About 4-propan-2-ylocta-1,7-dien-4-ol;dihydrochloride
4-propan-2-ylocta-1,7-dien-4-ol;dihydrochloride (PubChem CID 174848578) has the molecular formula C11H22Cl2O
and a molecular weight of 241.20 g/mol. Its IUPAC name is 4-propan-2-ylocta-1,7-dien-4-ol;dihydrochloride.
Molecular Properties
| Compound Name | 4-propan-2-ylocta-1,7-dien-4-ol;dihydrochloride |
| PubChem CID | 174848578 |
| Molecular Formula | C11H22Cl2O |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-propan-2-ylocta-1,7-dien-4-ol;dihydrochloride |
| SMILES | C=CCCC(O)(CC=C)C(C)C.Cl.Cl |
| InChI | InChI=1S/C11H20O.2ClH/c1-5-7-9-11(12,8-6-2)10(3)4;;/h5-6,10,12H,1-2,7-9H2,3-4H3;2*1H |
| InChIKey | IJRSBCBKFIRVIO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-propan-2-ylocta-1,7-dien-4-ol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-ylocta-1,7-dien-4-ol;dihydrochloride?
The IUPAC name of 4-propan-2-ylocta-1,7-dien-4-ol;dihydrochloride (CID 174848578) is 4-propan-2-ylocta-1,7-dien-4-ol;dihydrochloride.
What is the SMILES notation for 4-propan-2-ylocta-1,7-dien-4-ol;dihydrochloride?
The canonical SMILES for 4-propan-2-ylocta-1,7-dien-4-ol;dihydrochloride is C=CCCC(O)(CC=C)C(C)C.Cl.Cl.
What is the InChIKey of 4-propan-2-ylocta-1,7-dien-4-ol;dihydrochloride?
The InChIKey is IJRSBCBKFIRVIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O.2ClH/c1-5-7-9-11(12,8-6-2)10(3)4;;/h5-6,10,12H,1-2,7-9H2,3-4H3;2*1H.
What are the key properties of 4-propan-2-ylocta-1,7-dien-4-ol;dihydrochloride?
4-propan-2-ylocta-1,7-dien-4-ol;dihydrochloride has a molecular weight of 241.20 g/mol, XLogP of 3.76, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-ylocta-1,7-dien-4-ol;dihydrochloride is sourced from PubChem (CID 174848578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).