C14H31NO — CID 122631646
N-tert-butyl-2-methyl-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]propan-2-amine (PubChem CID 122631646) has the molecular formula C14H31NO and a molecular weight of 229.41 g/mol. Its IUPAC name is N-tert-butyl-2-methyl-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]propan-2-amine.
| Compound Name | N-tert-butyl-2-methyl-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]propan-2-amine |
|---|---|
| PubChem CID | 122631646 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | N-tert-butyl-2-methyl-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]propan-2-amine |
| SMILES | CC(C)(C)OCCN(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H31NO/c1-12(2,3)15(13(4,5)6)10-11-16-14(7,8)9/h10-11H2,1-9H3 |
| InChIKey | WCDARRWTZHYOGF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |