C15H35NO3 — CID 159353195
2-(2-methoxyethoxy)-2-methylpropane;N-(2-methoxyethyl)-N,2-dimethylpropan-2-amine (PubChem CID 159353195) has the molecular formula C15H35NO3 and a molecular weight of 277.45 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-2-methylpropane;N-(2-methoxyethyl)-N,2-dimethylpropan-2-amine.
| Compound Name | 2-(2-methoxyethoxy)-2-methylpropane;N-(2-methoxyethyl)-N,2-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 159353195 |
| Molecular Formula | C15H35NO3 |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.26 |
| IUPAC Name | 2-(2-methoxyethoxy)-2-methylpropane;N-(2-methoxyethyl)-N,2-dimethylpropan-2-amine |
| SMILES | COCCN(C)C(C)(C)C.COCCOC(C)(C)C |
| InChI | InChI=1S/C8H19NO.C7H16O2/c1-8(2,3)9(4)6-7-10-5;1-7(2,3)9-6-5-8-4/h6-7H2,1-5H3;5-6H2,1-4H3 |
| InChIKey | LHOYSULULSOHFU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|